Difference between revisions of "Alpha-D-Galactosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAMINE-5P == * common-name: ** pyridoxamine 5'-phosphate * smiles: ** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o) * inchi-key: ** z...")
(Created page with "Category:metabolite == Metabolite 5-AMINO-LEVULINATE == * common-name: ** 5-aminolevulinate * smiles: ** c(c(c[n+])=o)cc([o-])=o * inchi-key: ** zgxjtsgniosylo-uhfffaoysa-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXAMINE-5P ==
+
== Metabolite 5-AMINO-LEVULINATE ==
 
* common-name:
 
* common-name:
** pyridoxamine 5'-phosphate
+
** 5-aminolevulinate
 
* smiles:
 
* smiles:
** cc1(c(=c(c(cop([o-])([o-])=o)=cn=1)c[n+])o)
+
** c(c(c[n+])=o)cc([o-])=o
 
* inchi-key:
 
* inchi-key:
** zmjgsosnspkhnh-uhfffaoysa-m
+
** zgxjtsgniosylo-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 247.167
+
** 131.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PMPOXI-RXN]]
+
* [[PORPHOBILSYNTH-RXN]]
* [[PYAMPP]]
 
* [[RXN-14046]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYRAMKIN-RXN]]
+
* [[GSAAMINOTRANS-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxamine 5'-phosphate}}
+
{{#set: common-name=5-aminolevulinate}}
{{#set: inchi-key=inchikey=zmjgsosnspkhnh-uhfffaoysa-m}}
+
{{#set: inchi-key=inchikey=zgxjtsgniosylo-uhfffaoysa-n}}
{{#set: molecular-weight=247.167}}
+
{{#set: molecular-weight=131.131}}

Revision as of 08:31, 15 March 2021

Metabolite 5-AMINO-LEVULINATE

  • common-name:
    • 5-aminolevulinate
  • smiles:
    • c(c(c[n+])=o)cc([o-])=o
  • inchi-key:
    • zgxjtsgniosylo-uhfffaoysa-n
  • molecular-weight:
    • 131.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality