Difference between revisions of "Alpha-D-aldose-1-phosphates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12118 == * common-name: ** demethylmenaquinol-9 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1...")
(Created page with "Category:metabolite == Metabolite CPD-18539 == * common-name: ** (r)-n-formyl-β-hydroxy-l-kynurenine * smiles: ** [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-]) * in...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12118 ==
+
== Metabolite CPD-18539 ==
 
* common-name:
 
* common-name:
** demethylmenaquinol-9
+
** (r)-n-formyl-β-hydroxy-l-kynurenine
 
* smiles:
 
* smiles:
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)))c
+
** [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-])
 
* inchi-key:
 
* inchi-key:
** wjuvwmhfghnqjz-rnfptggasa-n
+
** gadduklgjyjxsl-wcbmzhexsa-n
 
* molecular-weight:
 
* molecular-weight:
** 773.236
+
** 252.226
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9205]]
+
* [[RXN-17150]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=demethylmenaquinol-9}}
+
{{#set: common-name=(r)-n-formyl-β-hydroxy-l-kynurenine}}
{{#set: inchi-key=inchikey=wjuvwmhfghnqjz-rnfptggasa-n}}
+
{{#set: inchi-key=inchikey=gadduklgjyjxsl-wcbmzhexsa-n}}
{{#set: molecular-weight=773.236}}
+
{{#set: molecular-weight=252.226}}

Revision as of 11:14, 15 January 2021

Metabolite CPD-18539

  • common-name:
    • (r)-n-formyl-β-hydroxy-l-kynurenine
  • smiles:
    • [ch](=o)nc1(c=cc=cc=1c(=o)c(o)c([n+])c(=o)[o-])
  • inchi-key:
    • gadduklgjyjxsl-wcbmzhexsa-n
  • molecular-weight:
    • 252.226

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality