Difference between revisions of "Alpha-hydroxyphytoceramides"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11404 == * common-name: ** 3,3',5-triiodothyroacetate * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc2(=cc(i)=c(o)c=c2)) * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite Alpha-hydroxyphytoceramides == * common-name: ** a (2'r)-2'-hydroxy-phytoceramide == Reaction(s) known to consume the compound == * RXN...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Alpha-hydroxyphytoceramides == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (2'r)-2'-hydroxy-phytoceramide |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN3O-581]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (2'r)-2'-hydroxy-phytoceramide}} |
| − | |||
| − | |||
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite Alpha-hydroxyphytoceramides
- common-name:
- a (2'r)-2'-hydroxy-phytoceramide
