Difference between revisions of "Alpha-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17464 == * transcription-direction: ** negative * right-end-position: ** 113575 * left-end-position: ** 96432 * centisome-position: ** 36.837463...")
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ17464 ==
+
== Metabolite 3Z-PHYTOCHROMOBILIN ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (3z)-phytochromobilin
−
* right-end-position:
+
* smiles:
−
** 113575
+
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
−
* left-end-position:
+
* inchi-key:
−
** 96432
+
** dkmlmzvdtgoegu-aikfxvfzsa-l
−
* centisome-position:
+
* molecular-weight:
−
** 36.837463   
+
** 582.655
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[1.3.7.4-RXN]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) of unknown directionality ==
−
* [[1.11.1.15-RXN]]
+
{{#set: common-name=(3z)-phytochromobilin}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: molecular-weight=582.655}}
−
* [[PEROXID-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-14240]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN0-5468]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=113575}}
 
−
{{#set: left-end-position=96432}}
 
−
{{#set: centisome-position=36.837463    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=7}}
 
−
{{#set: nb pathway associated=6}}
 

Revision as of 20:34, 18 December 2020

Metabolite 3Z-PHYTOCHROMOBILIN

  • common-name:
    • (3z)-phytochromobilin
  • smiles:
    • cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
  • inchi-key:
    • dkmlmzvdtgoegu-aikfxvfzsa-l
  • molecular-weight:
    • 582.655

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=Alpha-linolenoyl-groups&oldid=47042"