Difference between revisions of "Alpha-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3Z-PHYTOCHROMOBILIN == * common-name: ** (3z)-phytochromobilin * smiles: ** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)...")
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine55 == * common-name: ** a pseudouridine55 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3Z-PHYTOCHROMOBILIN ==
+
== Metabolite tRNA-pseudouridine55 ==
 
* common-name:
 
* common-name:
** (3z)-phytochromobilin
+
** a pseudouridine55 in trna
* smiles:
 
** cc=c1(c(c)c(nc1=cc4(=c(c)c(ccc([o-])=o)=c(c=c2(c(ccc([o-])=o)=c(c)c(=n2)c=c3(c(c)=c(c=c)c(=o)n3)))n4))=o)
 
* inchi-key:
 
** dkmlmzvdtgoegu-aikfxvfzsa-l
 
* molecular-weight:
 
** 582.655
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.3.7.4-RXN]]
+
* [[RXN-11839]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3z)-phytochromobilin}}
+
{{#set: common-name=a pseudouridine55 in trna}}
{{#set: inchi-key=inchikey=dkmlmzvdtgoegu-aikfxvfzsa-l}}
 
{{#set: molecular-weight=582.655}}
 

Revision as of 14:57, 5 January 2021

Metabolite tRNA-pseudouridine55

  • common-name:
    • a pseudouridine55 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality