Difference between revisions of "Alpha-linolenoyl-groups"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4822 == * common-name: ** kanamycin b * smiles: ** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]...")
(Created page with "Category:metabolite == Metabolite CPD-11398 == * common-name: ** l-thyroxine phenolic β-d-glucuronide * smiles: ** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-4822 ==
+
== Metabolite CPD-11398 ==
 
* common-name:
 
* common-name:
** kanamycin b
+
** l-thyroxine phenolic β-d-glucuronide
 
* smiles:
 
* smiles:
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(co)c(o)c([n+])c(o)3))[n+]))
+
** c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
 
* inchi-key:
 
* inchi-key:
** skklouvuunmcje-fqsmhnglsa-s
+
** rghrjbikiyuhev-sgpdefqssa-m
 
* molecular-weight:
 
* molecular-weight:
** 488.557
+
** 951.992
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14553]]
 
* [[RXN-15287]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10606]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=kanamycin b}}
+
{{#set: common-name=l-thyroxine phenolic β-d-glucuronide}}
{{#set: inchi-key=inchikey=skklouvuunmcje-fqsmhnglsa-s}}
+
{{#set: inchi-key=inchikey=rghrjbikiyuhev-sgpdefqssa-m}}
{{#set: molecular-weight=488.557}}
+
{{#set: molecular-weight=951.992}}

Revision as of 13:10, 14 January 2021

Metabolite CPD-11398

  • common-name:
    • l-thyroxine phenolic β-d-glucuronide
  • smiles:
    • c(=o)([o-])c([n+])cc1(=cc(i)=c(c(i)=c1)oc3(c=c(i)c(oc2(oc(c(=o)[o-])c(o)c(o)c(o)2))=c(i)c=3))
  • inchi-key:
    • rghrjbikiyuhev-sgpdefqssa-m
  • molecular-weight:
    • 951.992

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality