Difference between revisions of "Alpha-tubulins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12124 == * common-name: ** menaquinol-6 * smiles: ** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c...")
(Created page with "Category:metabolite == Metabolite Alpha-tubulins == * common-name: ** α-tubulin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the c...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-12124 ==
+
== Metabolite Alpha-tubulins ==
 
* common-name:
 
* common-name:
** menaquinol-6
+
** α-tubulin
* smiles:
 
** cc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc2(c(c)=c(o)c1(c=cc=cc=1c(o)=2)))c
 
* inchi-key:
 
** zventdgzqvbwna-rciygobdsa-n
 
* molecular-weight:
 
** 582.908
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9220]]
+
* [[6.3.2.25-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=menaquinol-6}}
+
{{#set: common-name=α-tubulin}}
{{#set: inchi-key=inchikey=zventdgzqvbwna-rciygobdsa-n}}
 
{{#set: molecular-weight=582.908}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite Alpha-tubulins

  • common-name:
    • α-tubulin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality