Difference between revisions of "Angiotensinogens"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ALPHA-ACETYLORNITHINE == * common-name: ** n-acetyl-l-ornithine * smiles: ** cc(=o)nc(ccc[n+])c(=o)[o-] * inchi-key: ** jrlgpaxaghmnol-...") |
(Created page with "Category:metabolite == Metabolite Cytochrome-c-N-O-methyl-arginines == * common-name: ** [cytochrome c]-nω-methyl-arginine == Reaction(s) known to consume the compou...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite N- | + | == Metabolite Cytochrome-c-N-O-methyl-arginines == |
* common-name: | * common-name: | ||
− | ** | + | ** [cytochrome c]-nω-methyl-arginine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.1.1.124-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=n- | + | {{#set: common-name=[cytochrome c]-nω-methyl-arginine}} |
− | |||
− |
Revision as of 08:27, 15 March 2021
Contents
Metabolite Cytochrome-c-N-O-methyl-arginines
- common-name:
- [cytochrome c]-nω-methyl-arginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "cytochrome c]-nω-methyl-arginine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.