Difference between revisions of "Apo-EntB"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-SEROTONIN == * common-name: ** n-acetyl-serotonin * smiles: ** cc(=o)nccc2(=cnc1(=c(c=c(o)c=c1)2)) * inchi-key: ** mvawjsidnickh...") |
(Created page with "Category:metabolite == Metabolite Beta-Lactams == * common-name: ** a β-lactam == Reaction(s) known to consume the compound == * BETA-LACTAMASE-RXN == Reaction(s)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Beta-Lactams == |
* common-name: | * common-name: | ||
| − | ** | + | ** a β-lactam |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[BETA-LACTAMASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a β-lactam}} |
| − | |||
| − | |||
Revision as of 14:58, 5 January 2021
Contents
Metabolite Beta-Lactams
- common-name:
- a β-lactam
