Difference between revisions of "Apo-EntF"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8624 == * common-name: ** a [protein]-l-proline (ω = 180) == Reaction(s) known to consume the compound == * PEPTIDYLPROLYL-IS...")
(Created page with "Category:metabolite == Metabolite DIMETHYL-D-RIBITYL-LUMAZINE == * common-name: ** 6,7-dimethyl-8-(1-d-ribityl)lumazine * smiles: ** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8624 ==
+
== Metabolite DIMETHYL-D-RIBITYL-LUMAZINE ==
 
* common-name:
 
* common-name:
** a [protein]-l-proline (ω = 180)
+
** 6,7-dimethyl-8-(1-d-ribityl)lumazine
 +
* smiles:
 +
** cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2))
 +
* inchi-key:
 +
** sxdxrjzuajbnfl-xkssxdpksa-m
 +
* molecular-weight:
 +
** 325.3
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[RIBOFLAVIN-SYN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
+
* [[LUMAZINESYN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [protein]-l-proline (ω = 180)}}
+
{{#set: common-name=6,7-dimethyl-8-(1-d-ribityl)lumazine}}
 +
{{#set: inchi-key=inchikey=sxdxrjzuajbnfl-xkssxdpksa-m}}
 +
{{#set: molecular-weight=325.3}}

Revision as of 18:52, 14 January 2021

Metabolite DIMETHYL-D-RIBITYL-LUMAZINE

  • common-name:
    • 6,7-dimethyl-8-(1-d-ribityl)lumazine
  • smiles:
    • cc2(=c(c)n(cc(o)c(o)c(o)co)c1(c(c(=o)[n-]c(=o)n=1)=n2))
  • inchi-key:
    • sxdxrjzuajbnfl-xkssxdpksa-m
  • molecular-weight:
    • 325.3

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality