Difference between revisions of "Apo-Propionyl-CoA-CO2-ligases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Farnesylated-CAAX-proteins == * common-name: ** a farnesylated protein that ends with a caax sequence == Reaction(s) known to consume the...")
(Created page with "Category:metabolite == Metabolite CPD-17046 == * common-name: ** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))(nc(=...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Farnesylated-CAAX-proteins ==
+
== Metabolite CPD-17046 ==
 
* common-name:
 
* common-name:
** a farnesylated protein that ends with a caax sequence
+
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
 +
* smiles:
 +
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
 +
* inchi-key:
 +
** yjisldwviydioe-wgtgpsahsa-l
 +
* molecular-weight:
 +
** 842.848
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11698]]
+
* [[RXN-15681]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17573]]
+
* [[RXN-15680]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a farnesylated protein that ends with a caax sequence}}
+
{{#set: common-name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
 +
{{#set: inchi-key=inchikey=yjisldwviydioe-wgtgpsahsa-l}}
 +
{{#set: molecular-weight=842.848}}

Revision as of 11:12, 15 January 2021

Metabolite CPD-17046

  • common-name:
    • 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o)(co)nc(=o)2))c(c(ncc([o-])=o)=o)nc(=o)ccc([n+])c([o-])=o
  • inchi-key:
    • yjisldwviydioe-wgtgpsahsa-l
  • molecular-weight:
    • 842.848

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality