Difference between revisions of "Apo-Propionyl-CoA-CO2-ligases"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE == * common-name: ** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=cccc(=cccc(=cc...")
(Created page with "Category:metabolite == Metabolite Apo-Propionyl-CoA-CO2-ligases == * common-name: ** apo-[propionyl-coa:carbon-dioxide ligase (adp-forming)] == Reaction(s) known to consum...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-45-DIHYDROXYBENZOATE ==
+
== Metabolite Apo-Propionyl-CoA-CO2-ligases ==
 
* common-name:
 
* common-name:
** 3,4-dihydroxy-5-all-trans-hexaprenylbenzoate
+
** apo-[propionyl-coa:carbon-dioxide ligase (adp-forming)]
* smiles:
 
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(=cc(c([o-])=o)=c1)o)o))c)c)c)c)c)c
 
* inchi-key:
 
** vepicjbqcouqpi-irvxxiiisa-m
 
* molecular-weight:
 
** 561.823
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.1.1.114-RXN]]
+
* [[6.3.4.10-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3,4-dihydroxy-5-all-trans-hexaprenylbenzoate}}
+
{{#set: common-name=apo-[propionyl-coa:carbon-dioxide ligase (adp-forming)]}}
{{#set: inchi-key=inchikey=vepicjbqcouqpi-irvxxiiisa-m}}
 
{{#set: molecular-weight=561.823}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Apo-Propionyl-CoA-CO2-ligases

  • common-name:
    • apo-[propionyl-coa:carbon-dioxide ligase (adp-forming)]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "apo-[propionyl-coa:carbon-dioxide ligase (adp-forming)" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.