Difference between revisions of "Apocytochromes-c"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15685 == * common-name: ** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa * smiles: ** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(...")
(Created page with "Category:metabolite == Metabolite Apocytochromes-c == * common-name: ** an apo-[c-type cytochrome] == Reaction(s) known to consume the compound == * HOLOCYTOCHROME-C-SYN...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15685 ==
+
== Metabolite Apocytochromes-c ==
 
* common-name:
 
* common-name:
** 2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa
+
** an apo-[c-type cytochrome]
* smiles:
 
** ccccccc=cc=ccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** xpvhxtguzgacru-mcfmhthasa-j
 
* molecular-weight:
 
** 967.814
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14797]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14796]]
+
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-trans, 5-cis, 7-trans-tetradecatrienoyl-coa}}
+
{{#set: common-name=an apo-[c-type cytochrome]}}
{{#set: inchi-key=inchikey=xpvhxtguzgacru-mcfmhthasa-j}}
 
{{#set: molecular-weight=967.814}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Apocytochromes-c

  • common-name:
    • an apo-[c-type cytochrome]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an apo-[c-type cytochrome" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.