Difference between revisions of "App-his-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-N-omega-methyl-arginine == * common-name: ** [protein]-nω-methyl-l-arginine == Reaction(s) known to consume the compound ==...") |
(Created page with "Category:metabolite == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == * common-name: ** d-myo-inositol (1,3,4)-trisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INOSITOL-1-3-4-TRIPHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** [ | + | ** d-myo-inositol (1,3,4)-trisphosphate |
| + | * smiles: | ||
| + | ** c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1) | ||
| + | * inchi-key: | ||
| + | ** mmwciqzxvozegg-mlqgymepsa-h | ||
| + | * molecular-weight: | ||
| + | ** 414.049 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.7.1.133-RXN]] |
| − | * [[RXN- | + | * [[2.7.1.139-RXN]] |
| + | * [[RXN-10939]] | ||
| + | * [[RXN-10959]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-8730]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=d-myo-inositol (1,3,4)-trisphosphate}} |
| + | {{#set: inchi-key=inchikey=mmwciqzxvozegg-mlqgymepsa-h}} | ||
| + | {{#set: molecular-weight=414.049}} | ||
Revision as of 11:17, 15 January 2021
Contents
Metabolite INOSITOL-1-3-4-TRIPHOSPHATE
- common-name:
- d-myo-inositol (1,3,4)-trisphosphate
- smiles:
- c1(o)(c(o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
- inchi-key:
- mmwciqzxvozegg-mlqgymepsa-h
- molecular-weight:
- 414.049
