Difference between revisions of "Aromatic-Amino-Acids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MAL == * common-name: ** (s)-malate * smiles: ** c(=o)([o-])cc(o)c([o-])=o * inchi-key: ** bjepykjpyrnkow-reohclbhsa-l * molecular-weight...") |
(Created page with "Category:metabolite == Metabolite Aromatic-Amino-Acids == * common-name: ** an aromatic amino acid == Reaction(s) known to consume the compound == * 2.6.1.57-RXN == Re...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Aromatic-Amino-Acids == |
* common-name: | * common-name: | ||
| − | ** | + | ** an aromatic amino acid |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[2.6.1.57-RXN]] |
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.6.1.57-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=an aromatic amino acid}} |
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Aromatic-Amino-Acids
- common-name:
- an aromatic amino acid
