Difference between revisions of "Aromatic-Oxoacids"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14601 == * common-name: ** mycophenolate * smiles: ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) * inchi-key: ** hpnsfsbz...") |
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine13 == * common-name: ** a pseudouridine13 in trna == Reaction(s) known to consume the compound == == Reaction(s) known...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite tRNA-pseudouridine13 == |
* common-name: | * common-name: | ||
− | ** | + | ** a pseudouridine13 in trna |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-11841]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a pseudouridine13 in trna}} |
− | |||
− |
Revision as of 08:27, 15 March 2021
Contents
Metabolite tRNA-pseudouridine13
- common-name:
- a pseudouridine13 in trna