Difference between revisions of "Aryl-beta-D-Glucosides"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14424 == * common-name: ** (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=...")
(Created page with "Category:metabolite == Metabolite Aryl-beta-D-Glucosides == * common-name: ** an aryl β-d-glucoside == Reaction(s) known to consume the compound == == Reaction(s) kno...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14424 ==
+
== Metabolite Aryl-beta-D-Glucosides ==
 
* common-name:
 
* common-name:
** (5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa
+
** an aryl β-d-glucoside
* smiles:
 
** ccc=ccc=ccc=ccc=ccc=ccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** kidydclnvxonef-pybsmvoosa-j
 
* molecular-weight:
 
** 1091.996
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-13444]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13443]]
+
* [[PHENOL-BETA-GLUCOSYLTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(5z,8z,11z,14z,17z)-3r-hydroxy-docosapentaenoyl-coa}}
+
{{#set: common-name=an aryl β-d-glucoside}}
{{#set: inchi-key=inchikey=kidydclnvxonef-pybsmvoosa-j}}
 
{{#set: molecular-weight=1091.996}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite Aryl-beta-D-Glucosides

  • common-name:
    • an aryl β-d-glucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality