Difference between revisions of "Aryl-sulfates"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLYCEROPHOSPHOGLYCEROL == * common-name: ** glycerophosphoglycerol * smiles: ** c(c(cop(occ(co)o)([o-])=o)o)o * inchi-key: ** llcsxhmjulh...") |
(Created page with "Category:metabolite == Metabolite Aryl-sulfates == * common-name: ** an aryl sulfate == Reaction(s) known to consume the compound == * ARYLSULFAT-RXN == Reaction(s) kn...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Aryl-sulfates == |
* common-name: | * common-name: | ||
− | ** | + | ** an aryl sulfate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[ARYLSULFAT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[ARYL-SULFOTRANSFERASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=an aryl sulfate}} |
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite Aryl-sulfates
- common-name:
- an aryl sulfate