Difference between revisions of "Aryl-sulfates"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9854 == * common-name: ** 3-(all-trans-heptaprenyl)benzene-1,2-diol * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=...")
(Created page with "Category:metabolite == Metabolite Aryl-sulfates == * common-name: ** an aryl sulfate == Reaction(s) known to consume the compound == * ARYLSULFAT-RXN == Reaction(s) kn...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9854 ==
+
== Metabolite Aryl-sulfates ==
 
* common-name:
 
* common-name:
** 3-(all-trans-heptaprenyl)benzene-1,2-diol
+
** an aryl sulfate
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(c(o)=c(o)c=cc=1))c)c)c)c)c)c
 
* inchi-key:
 
** ooykexozubwosx-nfdzfspwsa-n
 
* molecular-weight:
 
** 586.94
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9225]]
+
* [[ARYLSULFAT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ARYL-SULFOTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-(all-trans-heptaprenyl)benzene-1,2-diol}}
+
{{#set: common-name=an aryl sulfate}}
{{#set: inchi-key=inchikey=ooykexozubwosx-nfdzfspwsa-n}}
 
{{#set: molecular-weight=586.94}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite Aryl-sulfates

  • common-name:
    • an aryl sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality