Difference between revisions of "B-Hydroxy-cis-D5-dodecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14601 == * common-name: ** mycophenolate * smiles: ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) * inchi-key: ** hpnsfsbz...") |
(Created page with "Category:metabolite == Metabolite tRNA-pseudouridine-38-39 == * common-name: ** a pseudouridine38/39 in trna == Reaction(s) known to consume the compound == * [[RXN-12727]...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite tRNA-pseudouridine-38-39 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a pseudouridine38/39 in trna |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-12727]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-12727]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a pseudouridine38/39 in trna}} |
| − | |||
| − | |||
Revision as of 13:09, 14 January 2021
Contents
Metabolite tRNA-pseudouridine-38-39
- common-name:
- a pseudouridine38/39 in trna
