Difference between revisions of "B-Hydroxy-cis-D5-dodecenoyl-ACPs"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05576 == * transcription-direction: ** positive * right-end-position: ** 507445 * left-end-position: ** 503974 * centisome-position: ** 54.0635...") |
(Created page with "Category:metabolite == Metabolite CPD-14601 == * common-name: ** mycophenolate * smiles: ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) * inchi-key: ** hpnsfsbz...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-14601 == |
| − | * | + | * common-name: |
| − | ** | + | ** mycophenolate |
| − | * | + | * smiles: |
| − | ** | + | ** cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc) |
| − | * | + | * inchi-key: |
| − | ** | + | ** hpnsfsbzbahari-rudmxatfsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 319.333 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-13607]] |
| − | == Reaction(s) | + | * [[RXN-13608]] |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-13605]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=mycophenolate}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=hpnsfsbzbahari-rudmxatfsa-m}} |
| − | + | {{#set: molecular-weight=319.333}} | |
| − | {{#set: | ||
| − | |||
| − | |||
Revision as of 20:33, 18 December 2020
Contents
Metabolite CPD-14601
- common-name:
- mycophenolate
- smiles:
- cc(ccc([o-])=o)=ccc1(=c(c(c)=c2(coc(=o)c(=c(o)1)2))oc)
- inchi-key:
- hpnsfsbzbahari-rudmxatfsa-m
- molecular-weight:
- 319.333
