Difference between revisions of "BCAA-dehydrogenase-3MB-DH-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-506 == * common-name: ** d-myo-inositol (1,3,4,5)-tetrakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)...")
(Created page with "Category:metabolite == Metabolite NIACINE == * common-name: ** nicotinate * smiles: ** c1(=cc=c(c([o-])=o)c=n1) * inchi-key: ** pvniimvlhyawgp-uhfffaoysa-m * molecular-wei...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-506 ==
+
== Metabolite NIACINE ==
 
* common-name:
 
* common-name:
** d-myo-inositol (1,3,4,5)-tetrakisphosphate
+
** nicotinate
 
* smiles:
 
* smiles:
** c1(o)(c(op([o-])(=o)[o-])c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(o)c(op([o-])([o-])=o)1)
+
** c1(=cc=c(c([o-])=o)c=n1)
 
* inchi-key:
 
* inchi-key:
** cipfcgzlfxvxbg-cnwjwelysa-f
+
** pvniimvlhyawgp-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 492.013
+
** 122.103
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7184]]
+
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
* [[RXN-8730]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.1.127-RXN]]
 
* [[2.7.1.139-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-myo-inositol (1,3,4,5)-tetrakisphosphate}}
+
{{#set: common-name=nicotinate}}
{{#set: inchi-key=inchikey=cipfcgzlfxvxbg-cnwjwelysa-f}}
+
{{#set: inchi-key=inchikey=pvniimvlhyawgp-uhfffaoysa-m}}
{{#set: molecular-weight=492.013}}
+
{{#set: molecular-weight=122.103}}

Revision as of 15:26, 5 January 2021

Metabolite NIACINE

  • common-name:
    • nicotinate
  • smiles:
    • c1(=cc=c(c([o-])=o)c=n1)
  • inchi-key:
    • pvniimvlhyawgp-uhfffaoysa-m
  • molecular-weight:
    • 122.103

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality