Difference between revisions of "BCAA-dehydrogenase-DH-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12303 == * common-name: ** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine * smiles: ** cc(c)=...")
(Created page with "Category:metabolite == Metabolite CPD-14756 == * common-name: ** methylthiobenzoate * smiles: ** csc(c1(c=cc=cc=1))=o * inchi-key: ** rqvwtmcuthkgcm-uhfffaoysa-n * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD-12303 ==
+
== Metabolite CPD-14756 ==
 
* common-name:
 
* common-name:
−
** undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine
+
** methylthiobenzoate
 
* smiles:
 
* smiles:
−
** cc(c)=cccc(c)=cccc(c)=cccc(=cccc(=cccc(=cccc(c)=cccc(=cccc(=cccc(=cccc(=ccop(op([o-])(=o)oc1(c(nc(=o)c)c(oc(c)c(=o)nc(c)c(=o)nc(c(=o)[o-])ccc(=o)nc(cccc[n+])c(nc(c)c(=o)[o-])=o)c(o)c(co)o1))([o-])=o)c)c)c)c)c)c)c
+
** csc(c1(c=cc=cc=1))=o
 
* inchi-key:
 
* inchi-key:
−
** kcrofjgxxschga-ygmfixcysa-k
+
** rqvwtmcuthkgcm-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
−
** 1598.955
+
** 152.211
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-11347]]
+
* [[RXN-13725]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=undecaprenyl-diphospho-n-acetylmuramoyl-l-alanyl-γ-d-glutamyl-l-lysyl- d-alanine}}
+
{{#set: common-name=methylthiobenzoate}}
−
{{#set: inchi-key=inchikey=kcrofjgxxschga-ygmfixcysa-k}}
+
{{#set: inchi-key=inchikey=rqvwtmcuthkgcm-uhfffaoysa-n}}
−
{{#set: molecular-weight=1598.955}}
+
{{#set: molecular-weight=152.211}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-14756

  • common-name:
    • methylthiobenzoate
  • smiles:
    • csc(c1(c=cc=cc=1))=o
  • inchi-key:
    • rqvwtmcuthkgcm-uhfffaoysa-n
  • molecular-weight:
    • 152.211

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BCAA-dehydrogenase-DH-lipoyl&oldid=126397"