Difference between revisions of "BCAA-dehydrogenase-DH-lipoyl"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16654 RXN-16654] == * direction: ** left-to-right * common-name: ** aldehyde dehydrogenase (nad...")
(Created page with "Category:metabolite == Metabolite CPD-11700 == * common-name: ** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate * smiles: ** c1(op(=o)([o-])[o-])(c(op([o-])(=o)...")
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16654 RXN-16654] ==
+
== Metabolite CPD-11700 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** aldehyde dehydrogenase (nad)
+
** 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
−
** dodecanal dehydrogenase
+
* smiles:
−
* ec-number:
+
** c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
−
** [http://enzyme.expasy.org/EC/1.2.1.3 ec-1.2.1.3]
+
* inchi-key:
−
== Reaction formula ==
+
** uphpwxpnziozjl-uotptpdrsa-a
−
* 1 [[CPD-7880]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[DODECANOATE]][c] '''+''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 726.913
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ11331]]
+
* [[RXN-10974]]
−
** Category: [[annotation]]
+
* [[RXN-10975]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-10977]]
−
* Gene: [[SJ06359]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-10972]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-10975]]
−
* Gene: [[SJ10107]]
+
* [[RXN-10977]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: common-name=1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate}}
−
* Gene: [[SJ06456]]
+
{{#set: inchi-key=inchikey=uphpwxpnziozjl-uotptpdrsa-a}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=726.913}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ05897]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06047]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ17249]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ09287]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ06470]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ00435]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ11330]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ22552]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=aldehyde dehydrogenase (nad)|dodecanal dehydrogenase}}
 
−
{{#set: ec-number=ec-1.2.1.3}}
 
−
{{#set: nb gene associated=12}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-11700

  • common-name:
    • 1d-myo-inositol 1-diphosphate 2,3,4,5,6-pentakisphosphate
  • smiles:
    • c1(op(=o)([o-])[o-])(c(op([o-])(=o)[o-])c(op([o-])(=o)[o-])c(op(op([o-])(=o)[o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])1)
  • inchi-key:
    • uphpwxpnziozjl-uotptpdrsa-a
  • molecular-weight:
    • 726.913

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BCAA-dehydrogenase-DH-lipoyl&oldid=48229"