Difference between revisions of "BCCP-L-lysine"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite S-3-HYDROXYBUTANOYL-COA == * common-name: ** (s)-3-hydroxybutanoyl-coa * smiles: ** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1...")
(Created page with "Category:metabolite == Metabolite BCCP-L-lysine == * common-name: ** a [biotin carboxyl-carrier protein]-l-lysine == Reaction(s) known to consume the compound == * BIOTI...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite S-3-HYDROXYBUTANOYL-COA ==
+
== Metabolite BCCP-L-lysine ==
 
* common-name:
 
* common-name:
** (s)-3-hydroxybutanoyl-coa
+
** a [biotin carboxyl-carrier protein]-l-lysine
* smiles:
 
** cc(cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)o
 
* inchi-key:
 
** qhhkkmyhdbrony-vkbdfprvsa-j
 
* molecular-weight:
 
** 849.593
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HACD1h]]
+
* [[BIOTINLIG-RXN]]
* [[HBCHL]]
 
* [[HBCHLm]]
 
* [[HBCO]]
 
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
* [[RXN-11662]]
 
* [[RXN-11667]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
 
* [[HACD1h]]
 
* [[HBCHL]]
 
* [[HBCHLm]]
 
* [[HBCO_LPAREN_nadp_RPAREN_]]
 
* [[HBCO_LPAREN_nadp_RPAREN_m]]
 
* [[RXN-11662]]
 
* [[RXN-11667]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(s)-3-hydroxybutanoyl-coa}}
+
{{#set: common-name=a [biotin carboxyl-carrier protein]-l-lysine}}
{{#set: inchi-key=inchikey=qhhkkmyhdbrony-vkbdfprvsa-j}}
 
{{#set: molecular-weight=849.593}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite BCCP-L-lysine

  • common-name:
    • a [biotin carboxyl-carrier protein]-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [biotin carboxyl-carrier protein]-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.