Difference between revisions of "BENZALDEHYDE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite ACETYL-ETCETERA-L-ASPARAGINE == * common-name: ** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine * smiles: ** cc(=o)nc1(c(o)c(o)c(co)oc...")
(Created page with "Category:metabolite == Metabolite BENZALDEHYDE == * common-name: ** benzaldehyde * smiles: ** c(=o)c1(=cc=cc=c1) * inchi-key: ** humnylrzrppjdn-uhfffaoysa-n * molecular-we...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite ACETYL-ETCETERA-L-ASPARAGINE ==
+
== Metabolite BENZALDEHYDE ==
 
* common-name:
 
* common-name:
** n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine
+
** benzaldehyde
 
* smiles:
 
* smiles:
** cc(=o)nc1(c(o)c(o)c(co)oc(nc(=o)cc([n+])c(=o)[o-])1)
+
** c(=o)c1(=cc=cc=c1)
 
* inchi-key:
 
* inchi-key:
** yttrpbwemmpysw-hrrfrdkfsa-n
+
** humnylrzrppjdn-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 335.313
+
** 106.124
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.5.1.26-RXN]]
+
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n4-(β-n-acetyl-d-glucosaminyl)-l-asparagine}}
+
{{#set: common-name=benzaldehyde}}
{{#set: inchi-key=inchikey=yttrpbwemmpysw-hrrfrdkfsa-n}}
+
{{#set: inchi-key=inchikey=humnylrzrppjdn-uhfffaoysa-n}}
{{#set: molecular-weight=335.313}}
+
{{#set: molecular-weight=106.124}}

Latest revision as of 11:14, 18 March 2021

Metabolite BENZALDEHYDE

  • common-name:
    • benzaldehyde
  • smiles:
    • c(=o)c1(=cc=cc=c1)
  • inchi-key:
    • humnylrzrppjdn-uhfffaoysa-n
  • molecular-weight:
    • 106.124

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality