Difference between revisions of "BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 4-TOLUENECARBOXYLATE == * common-name: ** 4-toluenecarboxylate * smiles: ** cc1(c=cc(=cc=1)c(=o)[o-]) * inchi-key: ** lpnbbfkouusudb-uhff...") |
(Created page with "Category:metabolite == Metabolite BENZOATE == * common-name: ** benzoate * smiles: ** c(c1(c=cc=cc=1))([o-])=o * inchi-key: ** wpymklbdigxbtp-uhfffaoysa-m * molecular-weig...") |
||
| (5 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BENZOATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** benzoate |
* smiles: | * smiles: | ||
| − | ** | + | ** c(c1(c=cc=cc=1))([o-])=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** wpymklbdigxbtp-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 121.115 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[BENZALDEHYDE-DEHYDROGENASE-NAD+-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=benzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=wpymklbdigxbtp-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=121.115}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite BENZOATE
- common-name:
- benzoate
- smiles:
- c(c1(c=cc=cc=1))([o-])=o
- inchi-key:
- wpymklbdigxbtp-uhfffaoysa-m
- molecular-weight:
- 121.115
