Difference between revisions of "BENZOATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ADENOSYLCOBINAMIDE == * common-name: ** adenosylcobinamide * smiles: ** c[ch](cnc(ccc4(c8(n3([co--]17([n+]5(c(=c(c)c2(=[n+]1c(c(c2ccc(n)=...") |
(Created page with "Category:metabolite == Metabolite 4-TOLUENECARBOXYLATE == * common-name: ** 4-toluenecarboxylate * smiles: ** cc1(c=cc(=cc=1)c(=o)[o-]) * inchi-key: ** lpnbbfkouusudb-uhff...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 4-TOLUENECARBOXYLATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-toluenecarboxylate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc1(c=cc(=cc=1)c(=o)[o-]) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** lpnbbfkouusudb-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 135.142 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-8582]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-toluenecarboxylate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=lpnbbfkouusudb-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=135.142}} |
Revision as of 15:00, 5 January 2021
Contents
Metabolite 4-TOLUENECARBOXYLATE
- common-name:
- 4-toluenecarboxylate
- smiles:
- cc1(c=cc(=cc=1)c(=o)[o-])
- inchi-key:
- lpnbbfkouusudb-uhfffaoysa-m
- molecular-weight:
- 135.142
