Difference between revisions of "BENZOYLCOA"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ22556 == * transcription-direction: ** negative * right-end-position: ** 66802 * left-end-position: ** 60258 * centisome-position: ** 34.757076...") |
(Created page with "Category:metabolite == Metabolite BENZOYLCOA == * common-name: ** benzoyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite BENZOYLCOA == |
− | * | + | * common-name: |
− | ** | + | ** benzoyl-coa |
− | + | * smiles: | |
− | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-] | |
− | * | + | * inchi-key: |
− | ** | + | ** vevjtunlalkrno-tyhxjlicsa-j |
− | + | * molecular-weight: | |
− | + | ** 867.61 | |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | = | + | * [[RXN-2006]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=benzoyl-coa}} |
− | ** | + | {{#set: inchi-key=inchikey=vevjtunlalkrno-tyhxjlicsa-j}} |
− | * | + | {{#set: molecular-weight=867.61}} |
− | |||
− | ** | ||
− | == | ||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite BENZOYLCOA
- common-name:
- benzoyl-coa
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
- inchi-key:
- vevjtunlalkrno-tyhxjlicsa-j
- molecular-weight:
- 867.61