Difference between revisions of "BENZOYLSUCCINYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ04795 == * transcription-direction: ** negative * right-end-position: ** 40827 * left-end-position: ** 32432 * centisome-position: ** 6.418162...")
(Created page with "Category:metabolite == Metabolite BENZOYLSUCCINYL-COA == * common-name: ** benzoylsuccinyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-]...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ04795 ==
+
== Metabolite BENZOYLSUCCINYL-COA ==
* transcription-direction:
+
* common-name:
** negative
+
** benzoylsuccinyl-coa
* right-end-position:
+
* smiles:
** 40827
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 32432
+
** sgnpjinsckfitg-ihebcorqsa-i
* centisome-position:
+
* molecular-weight:
** 6.418162   
+
** 966.676
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-905]]
* [[IDS1]]
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=benzoylsuccinyl-coa}}
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=sgnpjinsckfitg-ihebcorqsa-i}}
* [[IDS2]]
+
{{#set: molecular-weight=966.676}}
** Category: [[orthology]]
 
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
* [[ISPH2-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RXN0-884]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[NONMEVIPP-PWY]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-7560]]
 
** '''9''' reactions found over '''9''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=40827}}
 
{{#set: left-end-position=32432}}
 
{{#set: centisome-position=6.418162    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=2}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite BENZOYLSUCCINYL-COA

  • common-name:
    • benzoylsuccinyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(c(=o)c1(=cc=cc=c1))cc(=o)[o-])cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • sgnpjinsckfitg-ihebcorqsa-i
  • molecular-weight:
    • 966.676

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality