Difference between revisions of "BENZOYLSUCCINYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8653 == * common-name: ** betanidin * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(=c1c=c(o)c(o)=c2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) * in...") |
(Created page with "Category:metabolite == Metabolite 1-4-beta-Xylan == * common-name: ** a (1→4)-β-d-xylan == Reaction(s) known to consume the compound == * 3.2.1.8-RXN * RXN...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 1-4-beta-Xylan == |
* common-name: | * common-name: | ||
| − | ** | + | ** a (1→4)-β-d-xylan |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[3.2.1.8-RXN]] |
| + | * [[RXN-9104]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9104]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (1→4)-β-d-xylan}} |
| − | |||
| − | |||
Revision as of 13:08, 14 January 2021
Contents
Metabolite 1-4-beta-Xylan
- common-name:
- a (1→4)-β-d-xylan
