Difference between revisions of "BETA-ACETYLGLUCOSAMINIDE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ07547 == * transcription-direction: ** negative * right-end-position: ** 73061 * left-end-position: ** 72435 * centisome-position: ** 15.9546 =...") |
(Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-key: ** dtosiqbpprvqhs-pdbxooch...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite LINOLENIC_ACID == |
| − | * | + | * common-name: |
| − | ** | + | ** α-linolenate |
| − | * | + | * smiles: |
| − | ** | + | ** ccc=ccc=ccc=ccccccccc(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** dtosiqbpprvqhs-pdbxoochsa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 277.426 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[LINOLENOYL-RXN]] |
| − | + | * [[LNLNCACOAL]] | |
| − | * [[ | + | * [[RXN-1321]] |
| − | * | + | * [[RXN-8497]] |
| − | * | + | * [[llcoas]] |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | {{#set: | + | * [[RXN-1501_METACYC18.5]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | {{#set: | + | {{#set: common-name=α-linolenate}} |
| − | + | {{#set: inchi-key=inchikey=dtosiqbpprvqhs-pdbxoochsa-m}} | |
| − | + | {{#set: molecular-weight=277.426}} | |
Revision as of 20:31, 18 December 2020
Contents
Metabolite LINOLENIC_ACID
- common-name:
- α-linolenate
- smiles:
- ccc=ccc=ccc=ccccccccc(=o)[o-]
- inchi-key:
- dtosiqbpprvqhs-pdbxoochsa-m
- molecular-weight:
- 277.426
