Difference between revisions of "BETA-ACETYLGLUCOSAMINIDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite LINOLENIC_ACID == * common-name: ** α-linolenate * smiles: ** ccc=ccc=ccc=ccccccccc(=o)[o-] * inchi-key: ** dtosiqbpprvqhs-pdbxooch...") |
(Created page with "Category:metabolite == Metabolite CPD-6082 == * common-name: ** 3-aminopropanal * smiles: ** c(cc[n+])=o * inchi-key: ** pcxdjqzlddhmgx-uhfffaoysa-o * molecular-weight: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-6082 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-aminopropanal |
* smiles: | * smiles: | ||
− | ** | + | ** c(cc[n+])=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** pcxdjqzlddhmgx-uhfffaoysa-o |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 74.102 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-6382]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-aminopropanal}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=pcxdjqzlddhmgx-uhfffaoysa-o}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=74.102}} |
Revision as of 14:54, 5 January 2021
Contents
Metabolite CPD-6082
- common-name:
- 3-aminopropanal
- smiles:
- c(cc[n+])=o
- inchi-key:
- pcxdjqzlddhmgx-uhfffaoysa-o
- molecular-weight:
- 74.102