Difference between revisions of "BETA-D-FRUCTOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...") |
(Created page with "Category:metabolite == Metabolite BETA-D-FRUCTOSE == * common-name: ** β-d-fructofuranose * smiles: ** c(o)c1(oc(o)(co)c(c1o)o) * inchi-key: ** rfsuneuaizkajo-arqdhwq...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BETA-D-FRUCTOSE == |
* common-name: | * common-name: | ||
| − | ** | + | ** β-d-fructofuranose |
* smiles: | * smiles: | ||
| − | ** c( | + | ** c(o)c1(oc(o)(co)c(c1o)o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rfsuneuaizkajo-arqdhwqxsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 180.157 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[FRUCTOKINASE-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=β-d-fructofuranose}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rfsuneuaizkajo-arqdhwqxsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=180.157}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite BETA-D-FRUCTOSE
- common-name:
- β-d-fructofuranose
- smiles:
- c(o)c1(oc(o)(co)c(c1o)o)
- inchi-key:
- rfsuneuaizkajo-arqdhwqxsa-n
- molecular-weight:
- 180.157
