Difference between revisions of "BETA-D-FRUCTOSE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DCMP == * common-name: ** dcmp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o * inchi-key: ** ncmvoabpesmrcp-shyzeuofs...")
(Created page with "Category:metabolite == Metabolite 23S-rRNA-uridine746 == * common-name: ** uridine746 in 23s rrna == Reaction(s) known to consume the compound == * RXN-11843 == Reacti...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DCMP ==
+
== Metabolite 23S-rRNA-uridine746 ==
 
* common-name:
 
* common-name:
** dcmp
+
** uridine746 in 23s rrna
* smiles:
 
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op([o-])([o-])=o
 
* inchi-key:
 
** ncmvoabpesmrcp-shyzeuofsa-l
 
* molecular-weight:
 
** 305.183
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATDCM]]
+
* [[RXN-11843]]
* [[DCMP-DEAMINASE-RXN]]
 
* [[RXN-7913]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[DCTP-PYROPHOSPHATASE-RXN]]
 
* [[RXN-14187]]
 
* [[RXN-14198]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=dcmp}}
+
{{#set: common-name=uridine746 in 23s rrna}}
{{#set: inchi-key=inchikey=ncmvoabpesmrcp-shyzeuofsa-l}}
 
{{#set: molecular-weight=305.183}}
 

Revision as of 14:57, 5 January 2021

Metabolite 23S-rRNA-uridine746

  • common-name:
    • uridine746 in 23s rrna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality