Difference between revisions of "BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17482 RXN-17482] == * direction: ** left-to-right == Reaction formula == * 1 CPD-18888[c] '...")
(Created page with "Category:metabolite == Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE == * common-name: ** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine * smiles: ** cc(=o)nc2(...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17482 RXN-17482] ==
+
== Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
−
== Reaction formula ==
+
* smiles:
−
* 1 [[CPD-18888]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-9091]][c] '''+''' 1 [[NADP]][c]
+
** cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
−
== Gene(s) associated with this reaction  ==
+
* inchi-key:
−
* Gene: [[SJ15264]]
+
** kfeujdwyngmdbv-rphkzzmbsa-n
−
** Category: [[annotation]]
+
* molecular-weight:
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
** 383.352
−
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
−
* [[PWY-7762]], bacteriochlorophyll b biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7762 PWY-7762]
+
* [[RXN-15268]]
−
** '''4''' reactions found over '''7''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
−
== Reconstruction information  ==
+
* [[N-ACETYLLACTOSAMINE-SYNTHASE-RXN]]
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-15268]]
−
== External links  ==
+
== Reaction(s) of unknown directionality ==
−
{{#set: direction=left-to-right}}
+
{{#set: common-name=β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine}}
−
{{#set: nb gene associated=1}}
+
{{#set: inchi-key=inchikey=kfeujdwyngmdbv-rphkzzmbsa-n}}
−
{{#set: nb pathway associated=1}}
+
{{#set: molecular-weight=383.352}}
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE

  • common-name:
    • β-d-galactosyl-(1→4)-n-acetyl-d-glucosamine
  • smiles:
    • cc(=o)nc2(c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))c(o)2)
  • inchi-key:
    • kfeujdwyngmdbv-rphkzzmbsa-n
  • molecular-weight:
    • 383.352

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BETA-D-GALACTOSYL-ETCETERA-GLUCOSAMINE&oldid=139393"