Difference between revisions of "BETA-TOCOPHEROL"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13883 RXN-13883] == * direction: ** left-to-right * common-name: ** ergost-7-enol c-5 desaturas...") |
(Created page with "Category:metabolite == Metabolite BETA-TOCOPHEROL == * common-name: ** β-tocopherol * smiles: ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) * inchi-key...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite BETA-TOCOPHEROL == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** β-tocopherol |
− | * | + | * smiles: |
− | ** | + | ** cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c)) |
− | + | * inchi-key: | |
− | + | ** wgvkwnupngfdfj-dqczwyhmsa-n | |
− | == | + | * molecular-weight: |
− | * | + | ** 416.686 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-2562]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-tocopherol}} | |
− | + | {{#set: inchi-key=inchikey=wgvkwnupngfdfj-dqczwyhmsa-n}} | |
− | ** | + | {{#set: molecular-weight=416.686}} |
− | == | ||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | == | ||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite BETA-TOCOPHEROL
- common-name:
- β-tocopherol
- smiles:
- cc(c)cccc(c)cccc(c)cccc1(c)(ccc2(=c(c(o)=cc(=c(o1)2)c)c))
- inchi-key:
- wgvkwnupngfdfj-dqczwyhmsa-n
- molecular-weight:
- 416.686