Difference between revisions of "BETAINE ALDEHYDE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * smiles: ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-] * inchi-key: ** nuhs...") |
(Created page with "Category:metabolite == Metabolite ALA-tRNAs == * common-name: ** a trnaala == Reaction(s) known to consume the compound == * ALANINE--TRNA-LIGASE-RXN == Reaction(s) kn...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite ALA-tRNAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a trnaala |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ALANINE--TRNA-LIGASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a trnaala}} |
| − | |||
| − | |||
Revision as of 13:12, 14 January 2021
Contents
Metabolite ALA-tRNAs
- common-name:
- a trnaala
