Difference between revisions of "BILIVERDINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ14429 == * transcription-direction: ** negative * right-end-position: ** 315586 * left-end-position: ** 303300 * centisome-position: ** 95.79881...") |
(Created page with "Category:metabolite == Metabolite 23-DIPHOSPHOGLYCERATE == * common-name: ** 2,3-diphospho-d-glycerate * smiles: ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] * inchi...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite 23-DIPHOSPHOGLYCERATE == |
| − | * | + | * common-name: |
| − | ** | + | ** 2,3-diphospho-d-glycerate |
| − | * | + | * smiles: |
| − | ** | + | ** c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-] |
| − | * | + | * inchi-key: |
| − | ** | + | ** xohueycvluuejj-uwtatzphsa-i |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 260.998 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-15509]] |
| − | == Reaction(s) | + | * [[RXN-15510]] |
| − | * [[ | + | * [[RXN-15511]] |
| − | * | + | * [[RXN-15512]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | * | + | * [[BISPHOSPHOGLYCERATE-MUTASE-RXN]] |
| − | * | + | * [[RXN-15509]] |
| − | + | * [[RXN-15510]] | |
| − | {{#set: | + | * [[RXN-15511]] |
| − | + | * [[RXN-15512]] | |
| − | {{#set: | + | * [[RXN-17276]] |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=2,3-diphospho-d-glycerate}} | |
| + | {{#set: inchi-key=inchikey=xohueycvluuejj-uwtatzphsa-i}} | ||
| + | {{#set: molecular-weight=260.998}} | ||
Revision as of 20:31, 18 December 2020
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- common-name:
- 2,3-diphospho-d-glycerate
- smiles:
- c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])c(=o)[o-]
- inchi-key:
- xohueycvluuejj-uwtatzphsa-i
- molecular-weight:
- 260.998
