Difference between revisions of "BIOTIN"

Revision as of 08:29, 15 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite CPD-7109 ==
+== Metabolite Nucleoside-Monophosphates ==
 * common-name:
-** 4-prenylphlorisovalerophenone
+** a nucleoside 5'-monophosphate
-* smiles:
-** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c
-* inchi-key:
-** lwlgkghhvbvdkb-uhfffaoysa-m
-* molecular-weight:
-** 277.339
 == Reaction(s) known to consume the compound ==
-* [[RXN-7810]]
+* [[RXN-14473]]
 == Reaction(s) known to produce the compound ==
-* [[RXN-7811]]
+* [[3.1.13.1-RXN]]
+* [[3.1.26.4-RXN]]
+* [[3.1.4.1-RXN]]
+* [[3.1.4.17-RXN]]
+* [[NUCLEOSIDE-DIPHOSPHATASE-RXN]]
+* [[NUCLEOTIDE-PYROPHOSPHATASE-RXN]]
+* [[RXN-14024]]
+* [[RXN0-4961]]
+* [[RXN0-6479]]
+* [[RXN0-6525]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=4-prenylphlorisovalerophenone}}
+{{#set: common-name=a nucleoside 5'-monophosphate}}
-{{#set: inchi-key=inchikey=lwlgkghhvbvdkb-uhfffaoysa-m}}
-{{#set: molecular-weight=277.339}}