Difference between revisions of "BIOTIN"

Latest revision as of 11:15, 18 March 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite GUANOSINE-5DP-3DP ==
+== Metabolite BIOTIN ==
 * common-name:
-** ppgpp
+** biotin
 * smiles:
-** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
+** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))
 * inchi-key:
-** bufllcufnheseh-uuokfmhzsa-i
+** ybjhbahktgyvgt-zkwxmuahsa-m
 * molecular-weight:
-** 598.123
+** 243.3
 == Reaction(s) known to consume the compound ==
-* [[GBDP]]
+* [[6.3.4.10-RXN]]
-* [[PPGPPSYN-RXN]]
+* [[6.3.4.11-RXN]]
+* [[6.3.4.9-RXN]]
+* [[BIOTINLIG-RXN]]
+* [[ExchangeSeed-BIOTIN]]
+* [[RXN0-7192]]
+* [[TransportSeed-BIOTIN]]
 == Reaction(s) known to produce the compound ==
-* [[GBDP]]
+* [[2.8.1.6-RXN]]
-* [[GDPPYPHOSKIN-RXN]]
+* [[ExchangeSeed-BIOTIN]]
+* [[RXN-17473]]
+* [[TransportSeed-BIOTIN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=ppgpp}}
+{{#set: common-name=biotin}}
-{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
+{{#set: inchi-key=inchikey=ybjhbahktgyvgt-zkwxmuahsa-m}}
-{{#set: molecular-weight=598.123}}
+{{#set: molecular-weight=243.3}}