Difference between revisions of "BIOTIN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8775 == * common-name: ** m-toluate * smiles: ** cc1(=cc(=cc=c1)c(=o)[o-]) * inchi-key: ** gpsduzxpycfosq-uhfffaoysa-m * molecular-we...") |
(Created page with "Category:metabolite == Metabolite BIOTIN == * common-name: ** biotin * smiles: ** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12)) * inchi-key: ** ybjhbahktgyvgt-zkwxmuahsa-m * m...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite BIOTIN == |
* common-name: | * common-name: | ||
− | ** | + | ** biotin |
* smiles: | * smiles: | ||
− | ** | + | ** c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12)) |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** ybjhbahktgyvgt-zkwxmuahsa-m |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 243.3 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[6.3.4.10-RXN]] | ||
+ | * [[6.3.4.11-RXN]] | ||
+ | * [[6.3.4.9-RXN]] | ||
+ | * [[BIOTINLIG-RXN]] | ||
+ | * [[ExchangeSeed-BIOTIN]] | ||
+ | * [[RXN0-7192]] | ||
+ | * [[TransportSeed-BIOTIN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[2.8.1.6-RXN]] |
+ | * [[ExchangeSeed-BIOTIN]] | ||
+ | * [[RXN-17473]] | ||
+ | * [[TransportSeed-BIOTIN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=biotin}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ybjhbahktgyvgt-zkwxmuahsa-m}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=243.3}} |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite BIOTIN
- common-name:
- biotin
- smiles:
- c1(sc(ccccc(=o)[o-])[ch]2(nc(=o)n[ch]12))
- inchi-key:
- ybjhbahktgyvgt-zkwxmuahsa-m
- molecular-weight:
- 243.3
Reaction(s) known to consume the compound
- 6.3.4.10-RXN
- 6.3.4.11-RXN
- 6.3.4.9-RXN
- BIOTINLIG-RXN
- ExchangeSeed-BIOTIN
- RXN0-7192
- TransportSeed-BIOTIN