Difference between revisions of "BIOTIN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite NMNH == * common-name: ** reduced β-nicotinamide d-ribonucleotide * smiles: ** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o...")
(Created page with "Category:metabolite == Metabolite CPD-24186 == == Reaction(s) known to consume the compound == * RXN-22203 == Reaction(s) known to produce the compound == * RXN-2219...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite NMNH ==
+
== Metabolite CPD-24186 ==
* common-name:
 
** reduced β-nicotinamide d-ribonucleotide
 
* smiles:
 
** c1(=c(cc=cn1c2(oc(cop(=o)([o-])[o-])c(o)c(o)2))c(n)=o)
 
* inchi-key:
 
** xqhmusrslnrvga-turqnecasa-l
 
* molecular-weight:
 
** 334.222
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-22203]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN0-4401]]
+
* [[RXN-22199]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=reduced β-nicotinamide d-ribonucleotide}}
 
{{#set: inchi-key=inchikey=xqhmusrslnrvga-turqnecasa-l}}
 
{{#set: molecular-weight=334.222}}
 

Revision as of 18:57, 14 January 2021

Metabolite CPD-24186

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality