Difference between revisions of "BIOTIN"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TransportSeed-CARBON-DIOXIDE TransportSeed-CARBON-DIOXIDE] == * direction: ** left-to-right == Reac...") |
(Created page with "Category:metabolite == Metabolite GUANOSINE-5DP-3DP == * common-name: ** ppgpp * smiles: ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GUANOSINE-5DP-3DP == |
− | * | + | * common-name: |
− | ** | + | ** ppgpp |
− | + | * smiles: | |
− | * | + | ** c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
− | == | + | * inchi-key: |
− | == | + | ** bufllcufnheseh-uuokfmhzsa-i |
− | == | + | * molecular-weight: |
− | * | + | ** 598.123 |
− | == | + | == Reaction(s) known to consume the compound == |
− | {{#set: | + | * [[GBDP]] |
− | + | * [[PPGPPSYN-RXN]] | |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | + | * [[GBDP]] | |
− | {{#set: | + | * [[GDPPYPHOSKIN-RXN]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=ppgpp}} | |
+ | {{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}} | ||
+ | {{#set: molecular-weight=598.123}} |
Revision as of 20:35, 18 December 2020
Contents
Metabolite GUANOSINE-5DP-3DP
- common-name:
- ppgpp
- smiles:
- c(op(=o)([o-])op(=o)(o)[o-])c1(oc(c(o)c(op([o-])(=o)op([o-])([o-])=o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- bufllcufnheseh-uuokfmhzsa-i
- molecular-weight:
- 598.123