Difference between revisions of "BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite EDTA == * common-name: ** edta * smiles: ** c(c[n+](cc([o-])=o)cc([o-])=o)[n+](cc([o-])=o)cc([o-])=o * inchi-key: ** kcxvzyzypllwcc-uhfff...") |
(Created page with "Category:metabolite == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == * common-name: ** rnase ii substrate with no poly-a tail == Reaction(s) known to consume the co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == |
* common-name: | * common-name: | ||
| − | ** | + | ** rnase ii substrate with no poly-a tail |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN0-6524]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=rnase ii substrate with no poly-a tail}} |
| − | |||
| − | |||
Revision as of 11:15, 15 January 2021
Contents
Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL
- common-name:
- rnase ii substrate with no poly-a tail
