Difference between revisions of "BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite RNASE-II-SUBSTRATE-WITH-NO-POLY-A-TAIL == * common-name: ** rnase ii substrate with no poly-a tail == Reaction(s) known to consume the co...") |
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == |
* common-name: | * common-name: | ||
| − | ** | + | ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate |
| + | * smiles: | ||
| + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c | ||
| + | * inchi-key: | ||
| + | ** whmxlrrvaneoog-mvfiekmpsa-l | ||
| + | * molecular-weight: | ||
| + | ** 715.004 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.5.1.42-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}} |
| + | {{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}} | ||
| + | {{#set: molecular-weight=715.004}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE
- common-name:
- 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
- inchi-key:
- whmxlrrvaneoog-mvfiekmpsa-l
- molecular-weight:
- 715.004
