Difference between revisions of "BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ20418 == * transcription-direction: ** positive * right-end-position: ** 344407 * left-end-position: ** 342734 * centisome-position: ** 30.17787...")
 
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ20418 ==
+
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
* transcription-direction:
+
* common-name:
** positive
+
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
* right-end-position:
+
* smiles:
** 344407
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
* left-end-position:
+
* inchi-key:
** 342734
+
** whmxlrrvaneoog-mvfiekmpsa-l
* centisome-position:
+
* molecular-weight:
** 30.17787   
+
** 715.004
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[2.5.1.42-RXN]]
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=715.004}}
{{#set: right-end-position=344407}}
 
{{#set: left-end-position=342734}}
 
{{#set: centisome-position=30.17787    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE

  • common-name:
    • 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • whmxlrrvaneoog-mvfiekmpsa-l
  • molecular-weight:
    • 715.004

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality