Difference between revisions of "BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ12478 == * transcription-direction: ** positive * right-end-position: ** 322833 * left-end-position: ** 318861 * centisome-position: ** 42.544296...")
(Created page with "Category:metabolite == Metabolite DADP == * common-name: ** dadp * smiles: ** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o * inchi-key: ** daeap...")
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ12478 ==
+
== Metabolite DADP ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** dadp
−
* right-end-position:
+
* smiles:
−
** 322833
+
** c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 318861
+
** daeapnuqqaicnr-rrkcrqdmsa-k
−
* centisome-position:
+
* molecular-weight:
−
** 42.544296   
+
** 408.18
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[DADPKIN-RXN]]
−
== Reaction(s) associated ==
+
* [[DATPtm]]
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[NDPK]]
−
* [[3.1.1.64-RXN]]
+
* [[NDPKm]]
−
** Category: [[annotation]]
+
* [[RXN-14192]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14215]]
−
* [[CARBOXYLESTERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[ADPREDUCT-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ATDAM]]
−
* [[RETINYL-PALMITATE-ESTERASE-RXN]]
+
* [[DAOTO]]
−
** Category: [[annotation]]
+
* [[DATCY]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[DATPtm]]
−
* [[RXN-10711]]
+
* [[DATUP]]
−
** Category: [[annotation]]
+
* [[DEOXYADENYLATE-KINASE-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-14214]]
−
* [[RXN-10767]]
+
* [[RXN0-747]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=dadp}}
−
* [[RXN-12086]]
+
{{#set: inchi-key=inchikey=daeapnuqqaicnr-rrkcrqdmsa-k}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=408.18}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12252]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12575]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-12579]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXNQT-4366]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[TRIACYLGLYCEROL-LIPASE-RXN]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6303]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-6857]]
 
−
** '''3''' reactions found over '''7''' reactions in the full pathway
 
−
* [[LIPAS-PWY]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=322833}}
 
−
{{#set: left-end-position=318861}}
 
−
{{#set: centisome-position=42.544296    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=11}}
 
−
{{#set: nb pathway associated=3}}
 

Revision as of 20:32, 18 December 2020

Metabolite DADP

  • common-name:
    • dadp
  • smiles:
    • c(c3(c(cc(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o))op(op([o-])([o-])=o)([o-])=o
  • inchi-key:
    • daeapnuqqaicnr-rrkcrqdmsa-k
  • molecular-weight:
    • 408.18

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE&oldid=46612"