Difference between revisions of "BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19229 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PEROXID-RXN ** Categor...")
(Created page with "Category:metabolite == Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE == * common-name: ** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate * smiles: ** cc(c)=cccc(c)=c...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ19229 ==
+
== Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE ==
−
== Organism(s) associated with this gene  ==
+
* common-name:
−
* [[S.japonica_carotenoid_curated]]
+
** 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
−
== Reaction(s) associated ==
+
* smiles:
−
* [[PEROXID-RXN]]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
−
** Category: [[orthology]]
+
* inchi-key:
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
** whmxlrrvaneoog-mvfiekmpsa-l
−
* [[RXN-14240]]
+
* molecular-weight:
−
** Category: [[orthology]]
+
** 715.004
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to consume the compound ==
−
* [[RXN-15288]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[2.5.1.42-RXN]]
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-17352]]
+
{{#set: common-name=2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=whmxlrrvaneoog-mvfiekmpsa-l}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=715.004}}
−
* [[RXN-8635]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE

  • common-name:
    • 2,3-bis-o-(geranylgeranyl)-sn-glycerol 1-phosphate
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=ccocc(cop([o-])([o-])=o)occ=c(c)ccc=c(c)ccc=c(c)ccc=c(c)c
  • inchi-key:
    • whmxlrrvaneoog-mvfiekmpsa-l
  • molecular-weight:
    • 715.004

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=BIS-GERANYLGERANYLGLYCEROL-PHOSPHATE&oldid=137796"