Difference between revisions of "BR-"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7648 RXN-7648] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:metabolite == Metabolite CPD-15152 == * common-name: ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7648 RXN-7648] ==
+
== Metabolite CPD-15152 ==
* direction:
+
* common-name:
** left-to-right
+
** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.14.11.9 ec-1.14.11.9]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
== Reaction formula ==
+
* inchi-key:
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-6991]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-6992]][c] '''+''' 1 [[SUC]][c]
+
** aftbilpwmusgin-mycgwmctsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
** 683.068
* Gene: [[SJ07557]]
+
== Reaction(s) known to consume the compound ==
** Category: [[orthology]]
+
* [[RXN-14177]]
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
* Gene: [[SJ14670]]
+
{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: molecular-weight=683.068}}
* Gene: [[SJ14677]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ08018]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ14675]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
* Gene: [[SJ14672]]
 
** Category: [[orthology]]
 
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
</div>
 
== Pathway(s) ==
 
* [[PWY-5059]], pinobanksin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5059 PWY-5059]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R07993 R07993]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-1.14.11.9}}
 
{{#set: nb gene associated=6}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=orthology}}
 
{{#set: reconstruction tool=pantograph}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:36, 18 December 2020

Metabolite CPD-15152

  • common-name:
    • 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
  • inchi-key:
    • aftbilpwmusgin-mycgwmctsa-n
  • molecular-weight:
    • 683.068

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality